disperse black 1 structure
|
Common Name | disperse black 1 | ||
|---|---|---|---|---|
| CAS Number | 6054-48-4 | Molecular Weight | 262.30900 | |
| Density | 1.26g/cm3 | Boiling Point | 513.3ºC at 760 mmHg | |
| Molecular Formula | C16H14N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.2ºC | |
| Name | 4-[(4-aminophenyl)diazenyl]naphthalen-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 513.3ºC at 760 mmHg |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.30900 |
| Flash Point | 264.2ºC |
| Exact Mass | 262.12200 |
| PSA | 76.76000 |
| LogP | 5.58200 |
| Index of Refraction | 1.681 |
| InChIKey | QDPSGELUBXFKSB-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N=Nc2ccc(N)c3ccccc23)cc1 |
| HS Code | 2927000090 |
|---|
|
~%
disperse black 1 CAS#:6054-48-4 |
| Literature: Meldola Journal of the Chemical Society, 1883 , vol. 43, p. 439 |
|
~%
disperse black 1 CAS#:6054-48-4 |
| Literature: Meldola Journal of the Chemical Society, 1883 , vol. 43, p. 439 |
|
~%
disperse black 1 CAS#:6054-48-4 |
| Literature: Meldola Journal of the Chemical Society, 1883 , vol. 43, p. 439 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,4'-diamino-1-benzenazonaphthalene |
| 4-((4-Aminophenyl)azo)naphthalen-1-amine |
| EINECS 227-966-8 |
| 4-(4-amino-phenylazo)-[1]naphthylamine |
| Anilin-(4 azo 4)-naphthylamin-(1) |
| D1616 |
| 1-Naphthalenamine,4-[(4-aminophenyl)azo] |
| 4-(4-Amino-phenylazo)-[1]naphthylamin |
| 1-Naphthalenamine,4-(2-(4-aminophenyl)diazenyl) |