1-METHYLPIPERIDIN-4-YL 2,2-DIPHENYL-2-PROPOXYACETATE structure
|
Common Name | 1-METHYLPIPERIDIN-4-YL 2,2-DIPHENYL-2-PROPOXYACETATE | ||
|---|---|---|---|---|
| CAS Number | 60569-19-9 | Molecular Weight | 367.48 | |
| Density | 1.08 g/cm3 | Boiling Point | 468.8ºC at 760 mmHg | |
| Molecular Formula | C23H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.6ºC | |
Use of 1-METHYLPIPERIDIN-4-YL 2,2-DIPHENYL-2-PROPOXYACETATEPropiverine is a potent antimuscarinic agent. Propiverine inhibits cellular calcium influx, thereby diminishing muscle spasm. Propiverine has neurotropic and musculotropic effects on the urinary bladder smooth muscle. Propiverine can used for overactive bladder (OAB) research[1][2]. |
| Name | (1-Methyl-4-piperidyl) 2,2-diphenyl-2-propoxy-acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Propiverine is a potent antimuscarinic agent. Propiverine inhibits cellular calcium influx, thereby diminishing muscle spasm. Propiverine has neurotropic and musculotropic effects on the urinary bladder smooth muscle. Propiverine can used for overactive bladder (OAB) research[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.08 g/cm3 |
|---|---|
| Boiling Point | 468.8ºC at 760 mmHg |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.48 |
| Flash Point | 134.6ºC |
| Exact Mass | 367.21500 |
| PSA | 38.77000 |
| LogP | 3.93210 |
| Index of Refraction | 1.57 |
| InChIKey | QPCVHQBVMYCJOM-UHFFFAOYSA-N |
| SMILES | CCCOC(C(=O)OC1CCN(C)CC1)(c1ccccc1)c1ccccc1 |
| HS Code | 2933399090 |
|---|
|
~%
1-METHYLPIPERID... CAS#:60569-19-9 |
| Literature: WO2014/39627 A1, ; Page/Page column 126 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Compound was evaluated for inhibition of rat Gabra1 in an in vitro assay with cellula...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-1
External Id: CHEMBL5291801
|
|
Name: Binding affinity towards rat Gabra1 in an in vitro assay with cellular components mea...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-1
External Id: CHEMBL5291798
|
|
Name: Human intestinal absorption in po dosed human
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL1116254
|
|
Name: Antagonist activity human CHRM1 in an in vitro cell-based assay measured by fluoresce...
Source: ChEMBL
Target: Muscarinic acetylcholine receptor M1
External Id: CHEMBL5291920
|
|
Name: Binding affinity towards human ESR1 in an in vitro cell free assay (NIBR assay) measu...
Source: ChEMBL
Target: Estrogen receptor
External Id: CHEMBL5291791
|
|
Name: Binding affinity towards human HRH3 in an in vitro assay with cellular components mea...
Source: ChEMBL
Target: Histamine H3 receptor
External Id: CHEMBL5291921
|
|
Name: Binding affinity towards human EDNRA in an in vitro assay with cellular components me...
Source: ChEMBL
Target: Endothelin-1 receptor
External Id: CHEMBL5291785
|
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
|
Name: Binding affinity towards human DRD2 in an in vitro assay with cellular components mea...
Source: ChEMBL
Target: D(2) dopamine receptor
External Id: CHEMBL5291781
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
| Propiverine |