3,3-Diphenylpropanoic acid structure
|
Common Name | 3,3-Diphenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 606-83-7 | Molecular Weight | 226.270 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 358.3±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | 151-154 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 255.3±14.4 °C | |
| Name | 3,3-Diphenylpropionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 358.3±11.0 °C at 760 mmHg |
| Melting Point | 151-154 °C(lit.) |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.270 |
| Flash Point | 255.3±14.4 °C |
| Exact Mass | 226.099380 |
| PSA | 37.30000 |
| LogP | 3.38 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | BZQGAPWJKAYCHR-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(c1ccccc1)c1ccccc1 |
| Water Solubility | slightly soluble |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25-S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00002717 |
| EINECS 210-125-4 |
| 3,3-Diphenylpropanoic acid |
| Benzenepropanoic acid, β-phenyl- |