2-(4-methylanilino)-5-nitrobenzoic acid structure
|
Common Name | 2-(4-methylanilino)-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 60645-17-2 | Molecular Weight | 272.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methylanilino)-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12N2O4 |
|---|---|
| Molecular Weight | 272.25600 |
| Exact Mass | 272.08000 |
| PSA | 95.15000 |
| LogP | 3.94120 |
| InChIKey | MWRTZOJKSYZCAG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2ccc([N+](=O)[O-])cc2C(=O)O)cc1 |
|
~78%
2-(4-methylanil... CAS#:60645-17-2 |
| Literature: Lan, Cong; Xia, Zhi-Ning; Li, Zheng-Hua; Liang, Rong-Hui Journal of Chemical Research, 2012 , vol. 36, # 12 p. 726 - 728 |
|
~%
2-(4-methylanil... CAS#:60645-17-2 |
| Literature: Dey; Doraiswami Journal of the Indian Chemical Society, 1933 , vol. 10, p. 309,320 |
| 4-Nitro-4'-methyl-diphenylamin-carbonsaeure-(2) |
| N-p-Tolyl-5-nitro-anthranilsaeuree |
| Benzoic acid,2-[(4-methylphenyl)amino]-5-nitro |
| 5-nitro-2-(4-tolylamino)benzoic acid |
| 5-Nitro-2-p-toluidino-benzoesaeure |
| 5-nitro-2-p-toluidino-benzoic acid |