n,n-diethyl-p-phenylenediamine sulfate
Modify Date: 2026-07-01 14:22:29
n,n-diethyl-p-phenylenediamine sulfate structure
|
Common Name | n,n-diethyl-p-phenylenediamine sulfate | ||
|---|---|---|---|---|
| CAS Number | 6065-27-6 | Molecular Weight | 262.32600 | |
| Density | N/A | Boiling Point | 261ºC at 760 mmHg | |
| Molecular Formula | C10H18N2O4S | Melting Point | 184-186ºC(lit.) | |
| MSDS | N/A | Flash Point | 108.9ºC | |
| Name | n,n-diethyl-p-phenylenediamine sulfate |
|---|
| Boiling Point | 261ºC at 760 mmHg |
|---|---|
| Melting Point | 184-186ºC(lit.) |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.32600 |
| Flash Point | 108.9ºC |
| Exact Mass | 262.09900 |
| PSA | 112.24000 |
| LogP | 3.12420 |
| InChIKey | AYLDJQABCMPYEN-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O |
| Water Solubility | H2O: 0.1 g/mL, clear |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| WGK Germany | 3 |
| RTECS | SS9625000 |
| HS Code | 2921590090 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1