1-[diazo(phenyl)methyl]-4-(trifluoromethyl)benzene structure
|
Common Name | 1-[diazo(phenyl)methyl]-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 60664-82-6 | Molecular Weight | 262.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[diazo(phenyl)methyl]-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9F3N2 |
|---|---|
| Molecular Weight | 262.23000 |
| Exact Mass | 262.07200 |
| PSA | 37.39000 |
| LogP | 3.85366 |
| InChIKey | JQYOBIUMRLNVAK-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=C(c1ccccc1)c1ccc(C(F)(F)F)cc1 |
|
~%
1-[diazo(phenyl... CAS#:60664-82-6 |
| Literature: Bethell,D. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 966 - 972 |
| Benzene,1-(diazophenylmethyl)-4-(trifluoromethyl) |