4-(Trifluoromethyl)-1,1'-biphenyl structure
|
Common Name | 4-(Trifluoromethyl)-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 398-36-7 | Molecular Weight | 222.20600 | |
| Density | 1.18g/cm3 | Boiling Point | 257.1ºC at 760mmHg | |
| Molecular Formula | C13H9F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.3ºC | |
| Name | 1-phenyl-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 257.1ºC at 760mmHg |
| Molecular Formula | C13H9F3 |
| Molecular Weight | 222.20600 |
| Flash Point | 95.3ºC |
| Exact Mass | 222.06600 |
| LogP | 4.37240 |
| Index of Refraction | 1.505 |
| InChIKey | OUMKBAHMPRLISR-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(-c2ccccc2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903999090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: Inhibition of human KSP motor domain by ATPase assay
Source: ChEMBL
Target: Kinesin-like protein KIF11
External Id: CHEMBL895158
|
| p-trifluoromethylphenylboronic acid |
| 4-trifluoro-methylbiphenyl |
| Ph-C6H4-p-CF3 |
| p-CF3-C6H4-Ph |