2-Naphthalenol,3-(1-methylethyl)-, 2-acetate structure
|
Common Name | 2-Naphthalenol,3-(1-methylethyl)-, 2-acetate | ||
|---|---|---|---|---|
| CAS Number | 60683-45-6 | Molecular Weight | 228.28600 | |
| Density | 1.08g/cm3 | Boiling Point | 328.9ºC at 760 mmHg | |
| Molecular Formula | C15H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115ºC | |
| Name | (3-propan-2-ylnaphthalen-2-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 328.9ºC at 760 mmHg |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.28600 |
| Flash Point | 115ºC |
| Exact Mass | 228.11500 |
| PSA | 26.30000 |
| LogP | 3.88850 |
| Index of Refraction | 1.573 |
| InChIKey | YGTFLCIGAQILQZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cc2ccccc2cc1C(C)C |
|
~%
2-Naphthalenol,... CAS#:60683-45-6 |
| Literature: Matsumoto, Takashi; Imai, Sachihiko; Yamamoto, Naoya Bulletin of the Chemical Society of Japan, 1988 , vol. 61, p. 911 - 920 |
|
~%
2-Naphthalenol,... CAS#:60683-45-6 |
| Literature: Matsumoto, Takashi; Imai, Sachihiko; Yamamoto, Naoya Bulletin of the Chemical Society of Japan, 1988 , vol. 61, p. 911 - 920 |
|
~%
2-Naphthalenol,... CAS#:60683-45-6 |
| Literature: Matsumoto, Takashi; Imai, Sachihiko; Yamamoto, Naoya Bulletin of the Chemical Society of Japan, 1988 , vol. 61, p. 911 - 920 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Acetoxy-3-isopropylnaphthalin |
| 2-acetoxy-3-isopropylnaphthalene |