UNII:1Z42YUG42K structure
|
Common Name | UNII:1Z42YUG42K | ||
|---|---|---|---|---|
| CAS Number | 20850-49-1 | Molecular Weight | 219.280 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 327.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO2 | Melting Point | 46-49ºC | |
| MSDS | N/A | Flash Point | 114.5±19.7 °C | |
| Name | 2-(3,4-Dimethoxyphenyl)-3-methylbutanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 327.3±37.0 °C at 760 mmHg |
| Melting Point | 46-49ºC |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.280 |
| Flash Point | 114.5±19.7 °C |
| Exact Mass | 219.125931 |
| PSA | 42.25000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | NFXAXMOAVPLEBH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C#N)C(C)C)cc1OC |
| Storage condition | -20°C Freezer |
| HS Code | 2926909090 |
|---|
|
~82%
UNII:1Z42YUG42K CAS#:20850-49-1 |
| Literature: Wang, Cheng; Wang, Tao; Zhou, Nan; Pan, Xiao-Yan; He, Huai-Zhen Journal of Asian Natural Products Research, 2014 , vol. 16, # 3 p. 304 - 311 |
|
~81%
UNII:1Z42YUG42K CAS#:20850-49-1 |
| Literature: Alfa Chemicals Italiana S.r.l. Patent: EP285890 A2, 1988 ; |
|
~70%
UNII:1Z42YUG42K CAS#:20850-49-1 |
| Literature: G. D. Searle and Co. Patent: US4681970 A1, 1987 ; |
|
~87%
UNII:1Z42YUG42K CAS#:20850-49-1 |
| Literature: Chen, Gang; Wang, Zheng; Wu, Jiang; Ding, Kuiling Organic Letters, 2008 , vol. 10, # 20 p. 4573 - 4576 |
|
~%
UNII:1Z42YUG42K CAS#:20850-49-1 |
| Literature: US4697035 A1, ; |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 244-082-8 |
| Benzeneacetonitrile, 3,4-dimethoxy-α-(1-methylethyl)- |
| 2-(3,4-Dimethoxyphenyl)-3-methylbutanenitrile |
| 2-(3,4-Dimethoxy pheny)-3-methylbutyronitrile |
| UNII:1Z42YUG42K |
| MFCD00800230 |