ethyl 5-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-2-[(4-methoxybenzoyl)amino]-4-methylthiophene-3-carboxylate structure
|
Common Name | ethyl 5-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-2-[(4-methoxybenzoyl)amino]-4-methylthiophene-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6069-01-8 | Molecular Weight | 540.93900 | |
| Density | 1.435g/cm3 | Boiling Point | 531.4ºC at 760 mmHg | |
| Molecular Formula | C24H20ClF3N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.2ºC | |
| Name | ethyl 5-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-2-[(4-methoxybenzoyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.435g/cm3 |
|---|---|
| Boiling Point | 531.4ºC at 760 mmHg |
| Molecular Formula | C24H20ClF3N2O5S |
| Molecular Weight | 540.93900 |
| Flash Point | 275.2ºC |
| Exact Mass | 540.07300 |
| PSA | 125.46000 |
| LogP | 6.87560 |
| Index of Refraction | 1.615 |
| InChIKey | SAGOXOOZDUQAAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(OC)cc2)sc(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)c1C |
|
~%
ethyl 5-[[2-chl... CAS#:6069-01-8 |
| Literature: Abramow; Maikowa Trudy Kazansk.chim.technol.Inst.Chem.Abstr., 1959 , # 26 p. 104,106 Trudy Kazansk.chim.technol.Inst.Chem.Abstr., 1960 , p. 24340 |
|
~90%
ethyl 5-[[2-chl... CAS#:6069-01-8 |
| Literature: Bettermann, Gerhard; Schomburg, Dietmar; Schmutzler, Reinhard Phosphorus and Sulfur and the Related Elements, 1986 , vol. 28, p. 327 - 336 |
| phosphorodichloridous acid 2-methoxy-ethyl ester |
| (2-methoxyethoxy)dichlorophosphine |
| HMS598C08 |
| Dichlorophosphorigsaeure-(2-methoxy-aethylester) |
| ETHYL 5-[[2-CHLORO-5-(TRIFLUOROMETHYL)PHENYL]CARBAMOYL]-2-[(4-METHOXYBENZOYL)AMINO]-4-METHYL-THIOPHENE-3-CARBOXYLATE |
| 2-Methoxyethyl-1-dichlorphosphit |
| Dichlor-<2-methoxy-aethyl>-phosphit |
| dichlorophosphoric acid-(2-methoxy-ethyl ester) |