WAY-311972
Modify Date: 2025-08-21 18:22:15
WAY-311972 structure
|
Common Name | WAY-311972 | ||
|---|---|---|---|---|
| CAS Number | 606948-76-9 | Molecular Weight | 440.28992 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 531.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H18BrN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.1±30.1 °C | |
Use of WAY-311972inhibitors of ATP-kinases |
| Name | WAY-311972 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.2±50.0 °C at 760 mmHg |
| Molecular Formula | C21H18BrN3O3 |
| Molecular Weight | 440.28992 |
| Flash Point | 275.1±30.1 °C |
| Exact Mass | 337.122650 |
| LogP | 3.78 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | NWLRMGZNQNVLCA-UHFFFAOYSA-N |
| SMILES | Cc1cccc(OCc2nc(C#N)c(NCc3ccc(F)cc3)o2)c1 |
| 4-Oxazolecarbonitrile, 5-[[(4-fluorophenyl)methyl]amino]-2-[(3-methylphenoxy)methyl]- |
| 5-[(4-Fluorobenzyl)amino]-2-[(3-methylphenoxy)methyl]-1,3-oxazole-4-carbonitrile |