2-methylbenzoic anhydride structure
|
Common Name | 2-methylbenzoic anhydride | ||
|---|---|---|---|---|
| CAS Number | 607-86-3 | Molecular Weight | 254.281 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 408.6±34.0 °C at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | 39 °C | |
| MSDS | N/A | Flash Point | 194.0±22.9 °C | |
| Name | 2-Methylbenzoic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.6±34.0 °C at 760 mmHg |
| Melting Point | 39 °C |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.281 |
| Flash Point | 194.0±22.9 °C |
| Exact Mass | 254.094299 |
| PSA | 43.37000 |
| LogP | 3.94 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | YLBSXJWDERHYFY-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(=O)OC(=O)c1ccccc1C |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 2-methyl-, anhydride |
| (2-methylbenzoyl) 2-methylbenzoate |
| 2-Methylbenzoic anhydride |