N-(2,4,6-tribromophenyl)acetamide
N-(2,4,6-tribromophenyl)acetamide structure
|
Common Name | N-(2,4,6-tribromophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 607-93-2 | Molecular Weight | 371.85100 | |
| Density | 2.173g/cm3 | Boiling Point | 413ºC at 760 mmHg | |
| Molecular Formula | C8H6Br3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2,4,6-tribromophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.173g/cm3 |
|---|---|
| Boiling Point | 413ºC at 760 mmHg |
| Molecular Formula | C8H6Br3NO |
| Molecular Weight | 371.85100 |
| Flash Point | 203.6ºC |
| Exact Mass | 368.80000 |
| PSA | 32.59000 |
| LogP | 4.58200 |
| Index of Refraction | 1.665 |
| InChIKey | FQSQCZNNIXYDIH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(Br)cc(Br)cc1Br |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2.4.6-Tribrom-acetanilid |
| acetic acid-(2,4,6-tribromo-anilide) |
| EINECS 210-147-4 |
| Acetamide,N-(2,4,6-tribromophenyl) |
| 2,4,6-tribromoacet-anilide |
| Essigsaeure-(2,4,6-tribrom-anilid) |
| 2,4,6-tribromo-N-acetylaniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of N-(2,4,6-tribromophenyl)acetamide? |
| A: Boiling point of N-(2,4,6-tribromophenyl)acetamide is 413ºC at 760 mmHg. |
| Q: What English synonyms does N-(2,4,6-tribromophenyl)acetamide have? |
| A: English synonyms of N-(2,4,6-tribromophenyl)acetamide: 2.4.6-Tribrom-acetanilid, acetic acid-(2,4,6-tribromo-anilide), EINECS 210-147-4, Acetamide,N-(2,4,6-tribromophenyl), 2,4,6-tribromoacet-anilide, Essigsaeure-(2,4,6-tribrom-anilid), 2,4,6-tribromo-N-acetylaniline. |
| Q: What is the LogP of N-(2,4,6-tribromophenyl)acetamide? |
| A: LogP of N-(2,4,6-tribromophenyl)acetamide is 4.58200. |
| Q: What is the CAS number of N-(2,4,6-tribromophenyl)acetamide? |
| A: CAS number of N-(2,4,6-tribromophenyl)acetamide is 607-93-2. |
| Q: What is the molecular formula of N-(2,4,6-tribromophenyl)acetamide? |
| A: Molecular formula of N-(2,4,6-tribromophenyl)acetamide is C8H6Br3NO. |
| Q: What is the Chinese name of 607-93-2? |
| A: Chinese name of 607-93-2 is 607-93-2. |
| Q: What is the polar surface area (PSA) of N-(2,4,6-tribromophenyl)acetamide? |
| A: Polar surface area (PSA) of N-(2,4,6-tribromophenyl)acetamide is 32.59000. |
| Q: What is the InChIKey of N-(2,4,6-tribromophenyl)acetamide? |
| A: InChIKey of N-(2,4,6-tribromophenyl)acetamide is FQSQCZNNIXYDIH-UHFFFAOYSA-N. |
| Q: What is the English name of N-(2,4,6-tribromophenyl)acetamide? |
| A: The English name of N-(2,4,6-tribromophenyl)acetamide is N-(2,4,6-tribromophenyl)acetamide. |
| Q: What is the SMILES notation of N-(2,4,6-tribromophenyl)acetamide? |
| A: SMILES notation of N-(2,4,6-tribromophenyl)acetamide is CC(=O)Nc1c(Br)cc(Br)cc1Br. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |