2,4-dichloro-6-methyl-3-(1-methylethyl)phenol structure
|
Common Name | 2,4-dichloro-6-methyl-3-(1-methylethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 60741-51-7 | Molecular Weight | 219.10800 | |
| Density | 1.23g/cm3 | Boiling Point | 282.4ºC at 760 mmHg | |
| Molecular Formula | C10H12Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.8ºC | |
| Name | 2,4-dichloro-6-methyl-3-propan-2-ylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 282.4ºC at 760 mmHg |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.10800 |
| Flash Point | 118.8ºC |
| Exact Mass | 218.02700 |
| PSA | 20.23000 |
| LogP | 4.13080 |
| Index of Refraction | 1.552 |
| InChIKey | ZIFSLTRSCLGLBD-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c(C(C)C)c(Cl)c1O |
| HS Code | 2908199090 |
|---|
|
~%
2,4-dichloro-6-... CAS#:60741-51-7 |
| Literature: Chem. Farb. v. Heyden Patent: DE583108 , 1928 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 20, p. 988 |
|
~%
2,4-dichloro-6-... CAS#:60741-51-7 |
| Literature: Chem. Farb. v. Heyden Patent: DE583108 , 1928 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 20, p. 988 |
|
~26%
2,4-dichloro-6-... CAS#:60741-51-7
Detail
|
| Literature: Miller, Bernard; Haggerty, John G. Journal of Organic Chemistry, 1986 , vol. 51, # 2 p. 174 - 179 |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,4-Dichlor-3-isopropyl-6-methyl-phenol |
| 2,4-dichloro-3-isopropyl-6-methyl-phenol |
| EINECS 262-400-3 |
| 3.5-Dichlor-2-hydroxy-p-cymol |
| 2,4-Dichloro-6-methyl-3-(1-methylethyl)phenol |