1,3,5-trinitro-2-(2,2,2-trinitroethyl)benzene structure
|
Common Name | 1,3,5-trinitro-2-(2,2,2-trinitroethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 60762-70-1 | Molecular Weight | 376.15000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4N6O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,5-trinitro-2-(2,2,2-trinitroethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H4N6O12 |
|---|---|
| Molecular Weight | 376.15000 |
| Exact Mass | 375.98900 |
| PSA | 274.92000 |
| LogP | 3.57680 |
| InChIKey | MERPBLCGSJQGEN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(CC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])c([N+](=O)[O-])c1 |
|
~%
1,3,5-trinitro-... CAS#:60762-70-1 |
| Literature: Reich; Rose; Wilson Journal of the Chemical Society, 1947 , p. 1234,1236 |
| Benzene,1,3,5-trinitro-2-(2,2,2-trinitroethyl) |
| 1,3,5-Trinitro-2-(2,2,2-trinitro-aethyl)-benzol |
| 1,3,5-trinitro-2-(2,2,2-trinitro-ethyl)-benzene |