3-(tert-butyl)-2-methoxybenzoic acid structure
|
Common Name | 3-(tert-butyl)-2-methoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 60772-81-8 | Molecular Weight | 208.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-2-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25400 |
| Exact Mass | 208.11000 |
| PSA | 46.53000 |
| LogP | 2.69090 |
| InChIKey | OYIWOKUBVZPUOS-UHFFFAOYSA-N |
| SMILES | COc1c(C(=O)O)cccc1C(C)(C)C |
|
~%
3-(tert-butyl)-... CAS#:60772-81-8 |
| Literature: Merck and Co., Inc. Patent: US4038396 A1, 1977 ; |
|
~%
3-(tert-butyl)-... CAS#:60772-81-8 |
| Literature: Tomioka, Hideo; Kimoto, Kohji; Murata, Hiroshi; Izawa, Yasuji Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 2 p. 471 - 477 |
| Benzoic acid,3-(1,1-dimethylethyl)-2-methoxy |
| 3-t-butyl-2-methoxybenzoic acid |