2'',4'',4-triaminobenzanilide structure
|
Common Name | 2'',4'',4-triaminobenzanilide | ||
|---|---|---|---|---|
| CAS Number | 60779-50-2 | Molecular Weight | 242.27600 | |
| Density | 1.383g/cm3 | Boiling Point | 430.9ºC at 760 mmHg | |
| Molecular Formula | C13H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.4ºC | |
| Name | 2'',4'',4-triaminobenzanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.383g/cm3 |
|---|---|
| Boiling Point | 430.9ºC at 760 mmHg |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.27600 |
| Flash Point | 214.4ºC |
| Exact Mass | 242.11700 |
| PSA | 107.16000 |
| LogP | 3.50210 |
| Index of Refraction | 1.78 |
| InChIKey | ODKSRCASCRILJO-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)Nc2ccc(N)cc2N)cc1 |
|
~%
2'',4'',4-triam... CAS#:60779-50-2 |
| Literature: Hoechster Farbw. Patent: DE70862 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 34 |
|
~%
2'',4'',4-triam... CAS#:60779-50-2 |
| Literature: Hoechster Farbw. Patent: DE70862 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 34 |
|
~%
2'',4'',4-triam... CAS#:60779-50-2 |
| Literature: Hoechster Farbw. Patent: DE70862 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 34 |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 2,4,4'-Trinitrobiphenyl-2'-carboxylic acid |
| 2',4',4-triaminobenzamide |
| 2',4,4'-nitrobiphenyl-2-carboxylic acid |
| 2',4',4-Triaminobenzanilid |
| 2',4,4'-trinitro-2-biphenylcarboxylic acid |
| 2',4',4-Triaminobenzanilide |
| 2,4,4'-Trinitro-2'-carboxybiphenyl |