2-(4-Nitrophenoxy)ethanamine structure
|
Common Name | 2-(4-Nitrophenoxy)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 60814-16-6 | Molecular Weight | 182.177 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 345.1±22.0 °C at 760 mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.5±22.3 °C | |
| Name | 2-(4-Nitrophenoxy)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.1±22.0 °C at 760 mmHg |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.177 |
| Flash Point | 162.5±22.3 °C |
| Exact Mass | 182.069138 |
| PSA | 81.07000 |
| LogP | 0.79 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | HIEVUCALPWFEFA-UHFFFAOYSA-N |
| SMILES | NCCOc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922299090 |
|---|
|
~%
2-(4-Nitropheno... CAS#:60814-16-6 |
| Literature: US2002/28832 A1, ; US 20020028832 A1 |
|
~%
2-(4-Nitropheno... CAS#:60814-16-6 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 58, # 4 p. 533 - 545 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethanamine,2-(4-nitrophenoxy) |
| 2-(p-nitrophenoxy)ethylamine |
| 2-(3,4-DICHLOROPHENYL)QUINOLINE-4-CARBOHYDRAZIDE |
| 2-(4-Nitrophenoxy)ethanamine |
| p-nitrophenoxyethylamine |
| Ethanamine, 2-(4-nitrophenoxy)- |
| 4-Nitrophenyl 2-aminoethyl ether |
| 2-(4-Nitrophenoxy)ethylamine |
| 2-(4-nitrophenoxy)-ethylamine |
| 2-(4-Nitro-phenoxy)-aethylamin |
| 2-(4-Nitrophenoxy)-1-ethanamine |