diethyl 2-morpholin-4-ylpropanedioate
Modify Date: 2025-09-18 22:00:10
diethyl 2-morpholin-4-ylpropanedioate structure
|
Common Name | diethyl 2-morpholin-4-ylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 6082-48-0 | Molecular Weight | 245.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-morpholin-4-ylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H19NO5 |
|---|---|
| Molecular Weight | 245.27200 |
| Exact Mass | 245.12600 |
| PSA | 65.07000 |
| InChIKey | XEBTXHKGDGKJRH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)N1CCOCC1 |
|
~74%
diethyl 2-morph... CAS#:6082-48-0 |
| Literature: Maier, Ludwig; Lea, Peter J. Phosphorus and Sulfur and the Related Elements, 1983 , vol. 17, p. 1 - 20 |
| Morpholinomalonsaeure-diaethylester |
| Diethyl-morpholinomalonat |
| Propanedioic acid,4-morpholinyl-,diethyl ester |
| morpholin-4-yl-malonic acid diethyl ester |