Magnesium bis(trifluoromethanesulfonate) structure
|
Common Name | Magnesium bis(trifluoromethanesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 60871-83-2 | Molecular Weight | 322.443 | |
| Density | N/A | Boiling Point | 162ºC at 760 mmHg | |
| Molecular Formula | C2F6MgO6S2 | Melting Point | ≥300 °C(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | magnesium trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 162ºC at 760 mmHg |
|---|---|
| Melting Point | ≥300 °C(lit.) |
| Molecular Formula | C2F6MgO6S2 |
| Molecular Weight | 322.443 |
| Exact Mass | 321.889099 |
| PSA | 131.16000 |
| LogP | 2.26440 |
| InChIKey | BZQRBEVTLZHKEA-UHFFFAOYSA-L |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Mg+2] |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| Hazard Class | 8.0 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Redox-inactive metal ions promoted the catalytic reactivity of non-heme manganese complexes towards oxygen atom transfer.
Dalton Trans. 44 , 9182-92, (2015) Redox-inactive metal ions can modulate the reactivity of redox-active metal ions in a variety of biological and chemical oxidations. Many synthetic models have been developed to help address the elusi... |
| Magnesium bis(trifluoromethanesulfonate) |
| magnesium,trifluoromethanesulfonate |
| Methanesulfonic acid, 1,1,1-trifluoro-, magnesium salt (2:1) |
| MFCD00042601 |