6-Benzylamino-7-deazapurine structure
|
Common Name | 6-Benzylamino-7-deazapurine | ||
|---|---|---|---|---|
| CAS Number | 60972-04-5 | Molecular Weight | 224.26100 | |
| Density | 1.331g/cm3 | Boiling Point | 452.5ºC at 760 mmHg | |
| Molecular Formula | C13H12N4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 227.4ºC | |
| Name | 6-Benzylamino-7-deazapurine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 452.5ºC at 760 mmHg |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.26100 |
| Flash Point | 227.4ºC |
| Exact Mass | 224.10600 |
| PSA | 53.60000 |
| LogP | 2.64300 |
| Index of Refraction | 1.752 |
| InChIKey | XQTDTJWTCBSTMC-UHFFFAOYSA-N |
| SMILES | c1ccc(CNc2ncnc3[nH]ccc23)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-benzyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |