4-(3 3 4 4 5 5 6 6 7 7 8 8 9 9 10 10 10- structure
|
Common Name | 4-(3 3 4 4 5 5 6 6 7 7 8 8 9 9 10 10 10- | ||
|---|---|---|---|---|
| CAS Number | 609816-23-1 | Molecular Weight | 553.25700 | |
| Density | 1.506g/cm3 | Boiling Point | 318.4ºC at 760 mmHg | |
| Molecular Formula | C17H12F17N | Melting Point | 57-63ºC | |
| MSDS | Chinese USA | Flash Point | 143.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 318.4ºC at 760 mmHg |
| Melting Point | 57-63ºC |
| Molecular Formula | C17H12F17N |
| Molecular Weight | 553.25700 |
| Flash Point | 143.8ºC |
| Exact Mass | 553.07000 |
| PSA | 26.02000 |
| LogP | 7.78760 |
| Index of Refraction | 1.373 |
| InChIKey | MNOIHTZEQBURKA-UHFFFAOYSA-N |
| SMILES | NCc1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| MFCD03788348 |
| 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)benzylamine |
| 4-(1H,1H,2H,2H-Perfluorodecyl)benzylamine |