Dinoseb methyl ether structure
|
Common Name | Dinoseb methyl ether | ||
|---|---|---|---|---|
| CAS Number | 6099-79-2 | Molecular Weight | 254.23900 | |
| Density | 1.248g/cm3 | Boiling Point | 367.9ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -26ºC | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | Dinoseb methyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 367.9ºC at 760 mmHg |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.23900 |
| Flash Point | -26ºC |
| Exact Mass | 254.09000 |
| PSA | 100.87000 |
| LogP | 4.07150 |
| Index of Refraction | 1.549 |
| InChIKey | UVYHORVGKZXEMP-UHFFFAOYSA-N |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC |
| Storage condition | 2-8°C |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H361f-H373-H411 |
| Precautionary Statements | P210-P261-P273-P281-P301 + P310-P331 |
| Hazard Codes | Xn,N,F |
| Risk Phrases | 22-67-65-62-51/53-48/20-38-11 |
| Safety Phrases | 36/37-61-62 |
| RIDADR | UN 3013 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-butan-2-yl-2-methoxy-3,5-dinitrobenzene |