(2,6-dichlorophenyl) (4-hydroxyphenyl) ketone
Modify Date: 2024-02-10 12:55:33
(2,6-dichlorophenyl) (4-hydroxyphenyl) ketone structure
|
Common Name | (2,6-dichlorophenyl) (4-hydroxyphenyl) ketone | ||
|---|---|---|---|---|
| CAS Number | 61002-53-7 | Molecular Weight | 267.10700 | |
| Density | 1.406g/cm3 | Boiling Point | 432.7ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.5ºC | |
| Name | (2,6-dichlorophenyl)-(4-hydroxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 432.7ºC at 760 mmHg |
| Molecular Formula | C13H8Cl2O2 |
| Molecular Weight | 267.10700 |
| Flash Point | 215.5ºC |
| Exact Mass | 265.99000 |
| PSA | 37.30000 |
| LogP | 3.93000 |
| Index of Refraction | 1.631 |
| InChIKey | MLWKCPQXHJATBQ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(O)cc1)c1c(Cl)cccc1Cl |
| HS Code | 2914700090 |
|---|
|
~%
(2,6-dichloroph... CAS#:61002-53-7 |
| Literature: Labor. Fournier Patent: FR2300552DE2605382 , 19761976 ; Chem.Abstr., 1976 , vol. 85, # 192382 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,6-Dichloro-4'-hydroxybenzophenone |
| EINECS 262-555-7 |
| (2,6-dichlorophenyl)(4-hydroxyphenyl)ketone |