triphenylstannyl 4-nitrobenzoate structure
|
Common Name | triphenylstannyl 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 61057-41-8 | Molecular Weight | 516.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H19NO4Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triphenylstannyl 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H19NO4Sn |
|---|---|
| Molecular Weight | 516.12400 |
| Exact Mass | 517.03400 |
| PSA | 85.95000 |
| LogP | 4.56110 |
| InChIKey | IGKJRHLTUXMSMZ-UHFFFAOYSA-M |
| SMILES | O=C(O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
triphenylstanny... CAS#:61057-41-8 |
| Literature: Molloy, Kieran C.; Blunden, Stephen J.; Hill, Robin Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1988 , p. 1259 - 1266 |
| Stannane,[(4-nitrobenzoyl)oxy]triphenyl |