Du-ter structure
|
Common Name | Du-ter | ||
|---|---|---|---|---|
| CAS Number | 76-87-9 | Molecular Weight | 367.029 | |
| Density | 1.54 | Boiling Point | N/A | |
| Molecular Formula | C18H16OSn | Melting Point | 124-126 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | fentin hydroxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54 |
|---|---|
| Melting Point | 124-126 °C(lit.) |
| Molecular Formula | C18H16OSn |
| Molecular Weight | 367.029 |
| Exact Mass | 368.022308 |
| PSA | 20.23000 |
| LogP | 1.64580 |
| InChIKey | NRHFWOJROOQKBK-UHFFFAOYSA-N |
| SMILES | O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| Water Solubility | <0.1 g/100 mL at 21 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05, GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311-H315-H318-H330-H335-H351-H361d-H371-H372-H410 |
| Precautionary Statements | P201-P260-P273-P280-P304 + P340 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+:Verytoxic;N:Dangerous for the environment; |
| Risk Phrases | R24/25;R36/37/38;R40;R41;R48/23;R50/53;R63 |
| Safety Phrases | S26-S28-S36/37/39-S45-S60-S61 |
| RIDADR | UN 3146 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | WH8575000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
|
Transactivation of the human retinoid X receptor by organotins: use of site-directed mutagenesis to identify critical amino acid residues for organotin-induced transactivation.
Metallomics 7 , 1180-8, (2015) Organotins, such as tributyltin (TBT) and triphenyltin (TPT), may disrupt endocrine activity in mammals arising from their ability to act as ligands for the retinoid X receptor (RXR) and the peroxisom... |
|
|
Influence of organotins on rat platelet aggregation mechanisms.
Environ. Res. 39(1) , 172-9, (1986) The effects of ten organotins on rat platelet aggregation mechanisms were examined. Bis(tri-n-butyltin)oxide was the most potent inhibitor of both ADP- and collagen-induced aggregation, and it was the... |
|
|
A biochromatographic technique for the quantitative estimation of triphenyltin fungicides.
J. Chromatogr. A. 435(1) , 210-8, (1988)
|
| Triphenylstannanylium hydroxide |
| Triphenyltin hydroxide |
| Stannanylium, triphenyl-, hydroxide (1:1) |
| Stannane,hydroxytriphenyl |
| hydroxytriphenyltin |
| Triphenyltinhydroxide |
| Fentin Hydroxide |
| EINECS 200-990-6 |
| Brestan |
| fenolovo |
| triphenyltin,hydrate |
| MFCD00013928 |
| triphenylhydroxytin |
| Du-ter |
| Triphenylstannanol |
| Dowco 186 |
| Hydroxytriphenylstannane |
| triphenylstannyl hydroxide |
| Vancide ks |
| Erithane |
| Triphenyltin oxide |