1-(4-methoxyphenyl)-2,2-dimethylhexan-1-one structure
|
Common Name | 1-(4-methoxyphenyl)-2,2-dimethylhexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61067-11-6 | Molecular Weight | 234.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-2,2-dimethylhexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H22O2 |
|---|---|
| Molecular Weight | 234.33400 |
| Exact Mass | 234.16200 |
| PSA | 26.30000 |
| LogP | 4.09430 |
| InChIKey | UAAFWWAINQAGKC-UHFFFAOYSA-N |
| SMILES | CCCCC(C)(C)C(=O)c1ccc(OC)cc1 |
|
~%
1-(4-methoxyphe... CAS#:61067-11-6 |
| Literature: Couture,A. et al. Journal of the American Chemical Society, 1976 , vol. 98, p. 6218 - 6225 |
| 1-Hexanone,1-(4-methoxyphenyl)-2,2-dimethyl |
| 1-p-Anisyl-2,2-dimethyl-1-hexanon |