Hydrazinecarboximidamide,2-([1,1'-biphenyl]-4-ylmethylene) structure
|
Common Name | Hydrazinecarboximidamide,2-([1,1'-biphenyl]-4-ylmethylene) | ||
|---|---|---|---|---|
| CAS Number | 61072-53-5 | Molecular Weight | 238.28800 | |
| Density | 1.16g/cm3 | Boiling Point | 446ºC at 760 mmHg | |
| Molecular Formula | C14H14N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.5ºC | |
| Name | 2-[(E)-(4-phenylphenyl)methylideneamino]guanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 446ºC at 760 mmHg |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.28800 |
| Flash Point | 223.5ºC |
| Exact Mass | 238.12200 |
| PSA | 74.26000 |
| LogP | 3.36150 |
| Index of Refraction | 1.622 |
| InChIKey | KBXNOPYJIHLROM-LICLKQGHSA-N |
| SMILES | NC(N)=NN=Cc1ccc(-c2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
Hydrazinecarbox... CAS#:61072-53-5 |
| Literature: Cavallini,G. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1961 , vol. 4, p. 177 - 182 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| t0510-3496 |