N-(2-hydroxyethyl)-3-nitro-benzenesulfenamide structure
|
Common Name | N-(2-hydroxyethyl)-3-nitro-benzenesulfenamide | ||
|---|---|---|---|---|
| CAS Number | 61076-27-5 | Molecular Weight | 214.24200 | |
| Density | 1.38g/cm3 | Boiling Point | 383.7ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.8ºC | |
| Name | 2-[(3-nitrophenyl)sulfanylamino]ethanol |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 383.7ºC at 760 mmHg |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.24200 |
| Flash Point | 185.8ºC |
| Exact Mass | 214.04100 |
| PSA | 103.38000 |
| LogP | 2.09790 |
| Index of Refraction | 1.635 |
| InChIKey | NVFBDBQCGAEBHJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(SNCCO)c1 |
|
~%
N-(2-hydroxyeth... CAS#:61076-27-5 |
| Literature: Davis,F.A. et al. Journal of Organic Chemistry, 1977 , vol. 42, # 6 p. 967 - 972 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |