Megasul structure
|
Common Name | Megasul | ||
|---|---|---|---|---|
| CAS Number | 537-91-7 | Molecular Weight | 308.333 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 443.6±30.0 °C at 760 mmHg | |
| Molecular Formula | C12H8N2O4S2 | Melting Point | 78-80 °C(lit.) | |
| MSDS | N/A | Flash Point | 222.1±24.6 °C | |
Use of MegasulNitrophenide is a bioactive chemical. |
| Name | Bis(3-nitrophenyl) disulfide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 443.6±30.0 °C at 760 mmHg |
| Melting Point | 78-80 °C(lit.) |
| Molecular Formula | C12H8N2O4S2 |
| Molecular Weight | 308.333 |
| Flash Point | 222.1±24.6 °C |
| Exact Mass | 307.992554 |
| PSA | 142.24000 |
| LogP | 4.06 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | ODOFDWDUSSFUMN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(SSc2cccc([N+](=O)[O-])c2)c1 |
| Hazard Codes | N:Dangerousfortheenvironment; |
|---|---|
| Risk Phrases | R50/53 |
| Safety Phrases | S60-S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | JO1550000 |
| Packaging Group | III |
| HS Code | 2930909090 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Bis(m-nitrophenyl) disulfide |
| Bis(3-nitrophenyl) Disulfide |
| 3-Nitrophenyl disulfide |
| Megasul |
| NITROPHENIDE |
| 1,1'-Disulfanediylbis(3-nitrobenzene) |
| Disulfide, bis(3-nitrophenyl) |
| Disulfide, bis(m-nitrophenyl) (8CI) |
| m,m'-Dinitrodiphenyl disulfide |
| Bis(3-nitrophenyl)disulfide |
| Disulfide, bis(m-nitrophenyl) |
| 1-nitro-3-[(3-nitrophenyl)disulfanyl]benzene |
| MFCD00003573 |
| 3,3'-Dinitrodiphenyl disulfide |
| EINECS 208-677-6 |