Benzenesulfonamide,4-methyl-N-[(4-methylphenyl)sulfonyl]-N-(phenylmethyl)- structure
|
Common Name | Benzenesulfonamide,4-methyl-N-[(4-methylphenyl)sulfonyl]-N-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 61079-82-1 | Molecular Weight | 415.52600 | |
| Density | 1.307g/cm3 | Boiling Point | 585.1ºC at 760mmHg | |
| Molecular Formula | C21H21NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.7ºC | |
| Name | N-benzyl-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.307g/cm3 |
|---|---|
| Boiling Point | 585.1ºC at 760mmHg |
| Molecular Formula | C21H21NO4S2 |
| Molecular Weight | 415.52600 |
| Flash Point | 307.7ºC |
| Exact Mass | 415.09100 |
| PSA | 88.28000 |
| LogP | 6.04480 |
| Index of Refraction | 1.619 |
| InChIKey | KSTUIINIXOKEPG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
|
~70%
Benzenesulfonam... CAS#:61079-82-1 |
| Literature: M<*>ller, Paul; Thi, Minh Phuong Nguyen Helvetica Chimica Acta, 1980 , vol. 63, # 8 p. 2168 - 2172 |
|
~%
Benzenesulfonam... CAS#:61079-82-1 |
| Literature: Angyal et al. Journal of the Chemical Society, 1949 , p. 2704 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| N.N-Di-p-toluolsulfonyl-benzylamin |
| N-Benzyl-di-(p-toluolsulfon)-amid |
| N-Benzyl-N.N-di(p-toluolsulfonyl)-sulfonamid |
| Benzyl-bis-(toluol-4-sulfonyl)-amin |
| benzyl-bis-(toluene-4-sulfonyl)-amine |
| N,N-ditosylbenzylamine |
| Di-(toluol-sulfonyl-(4))-benzyl-amin |