2-(TRIPHENYLPHOSPHONIO)ETHYL CHLORO- structure
|
Common Name | 2-(TRIPHENYLPHOSPHONIO)ETHYL CHLORO- | ||
|---|---|---|---|---|
| CAS Number | 61083-59-8 | Molecular Weight | 325.79200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H19ClP+ | Melting Point | -130ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-carbonochloridoyloxyethyl(triphenyl)phosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | -130ºC (dec.) |
|---|---|
| Molecular Formula | C20H19ClP+ |
| Molecular Weight | 325.79200 |
| Exact Mass | 325.09100 |
| PSA | 13.59000 |
| LogP | 4.21930 |
| InChIKey | PUPJXJKSQGVMLT-UHFFFAOYSA-M |
| SMILES | O=C(Cl)OCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Risk Phrases | 34-36/37 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| Packaging Group | III |
| HS Code | 2931900090 |
|
~%
2-(TRIPHENYLPHO... CAS#:61083-59-8 |
| Literature: Kunz,H. Chemische Berichte, 1976 , vol. 109, p. 2670 - 2683 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
H. Kunz
Angew. Chem. Int. Ed. Engl. 99 , 297, (1987)
|
|
|
H. Kunz, H.-G. Lerchen
Angew. Chem. Int. Ed. Engl. 96 , 798, (1984)
|
| Chlorameisensaeure-<2-(triphenylphosphino)aethylester>chlorid |
| Chloroformic acid 2-(triphenylphosphonio)ethyl ester chloride |
| EINECS 262-582-4 |
| PEOC-Cl |
| (2-((Chloroformyl)oxy)ethyl)triphenylphosphonium chloride |
| 2-(Triphenylphosphonio)ethyl chloroformate chloride |
| inverted exclamation mark(R)Kunz inverted exclamation marka-Reagent |
| (2-Triphenylphosphonio)-ethoxycarbonyl-chlorid |
| 2-carbonochloridoyloxyethyl(triphenyl)phosphanium chloride |
| Chlorameisensaeure-2-(triphenylphosphonioethyl)ester-chlorid |