LH-21 structure
|
Common Name | LH-21 | ||
|---|---|---|---|---|
| CAS Number | 611207-11-5 | Molecular Weight | 408.75 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 545.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C20H20Cl3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.5±32.9 °C | |
Use of LH-21LH-21 is a potent in vivo neutral cannabinoid CB1 receptor antagonist. LH-21 reduces food intake and body weight gain in obese Zucker rats., and displays efficacy as a feeding inhibitor[1]. |
| Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-hexyl-1,2,4-triazole |
|---|---|
| Synonym | More Synonyms |
| Description | LH-21 is a potent in vivo neutral cannabinoid CB1 receptor antagonist. LH-21 reduces food intake and body weight gain in obese Zucker rats., and displays efficacy as a feeding inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 545.1±60.0 °C at 760 mmHg |
| Molecular Formula | C20H20Cl3N3 |
| Molecular Weight | 408.75 |
| Flash Point | 283.5±32.9 °C |
| Exact Mass | 407.072296 |
| PSA | 30.71000 |
| LogP | 8.65 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | USJFDADYVUDVAX-UHFFFAOYSA-N |
| SMILES | CCCCCCc1nc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2Cl)n1 |
| 1H-1,2,4-Triazole, 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-hexyl- |
| lh 21 |
| 5-(4-Chlorophenyl)-1-(2,4-dichlorophenyl)-3-hexyl-1H-1,2,4-triazole |
| LH-21 |