L-Cysteine, S-[ (4-fluorophenyl)diphenylmethyl]- structure
|
Common Name | L-Cysteine, S-[ (4-fluorophenyl)diphenylmethyl]- | ||
|---|---|---|---|---|
| CAS Number | 61137-66-4 | Molecular Weight | 381.46300 | |
| Density | 1.275g/cm3 | Boiling Point | 523.4ºC at 760 mmHg | |
| Molecular Formula | C22H20FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.3ºC | |
| Name | 2-amino-3-[(4-fluorophenyl)-diphenylmethyl]sulfanylpropanoic acid |
|---|
| Density | 1.275g/cm3 |
|---|---|
| Boiling Point | 523.4ºC at 760 mmHg |
| Molecular Formula | C22H20FNO2S |
| Molecular Weight | 381.46300 |
| Flash Point | 270.3ºC |
| Exact Mass | 381.12000 |
| PSA | 88.62000 |
| LogP | 4.96300 |
| Index of Refraction | 1.63 |
| InChIKey | GYNSTRCJYLZSGY-UHFFFAOYSA-N |
| SMILES | NC(CSC(c1ccccc1)(c1ccccc1)c1ccc(F)cc1)C(=O)O |
|
~%
L-Cysteine, S-[... CAS#:61137-66-4 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 414 - 418 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |