L-Cysteine, S-[ (4-bromophenyl)diphenylmethyl]- structure
|
Common Name | L-Cysteine, S-[ (4-bromophenyl)diphenylmethyl]- | ||
|---|---|---|---|---|
| CAS Number | 61137-67-5 | Molecular Weight | 442.36900 | |
| Density | 1.421g/cm3 | Boiling Point | 568.9ºC at 760 mmHg | |
| Molecular Formula | C22H20BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.9ºC | |
| Name | 2-amino-3-[(4-bromophenyl)-diphenylmethyl]sulfanylpropanoic acid |
|---|
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 568.9ºC at 760 mmHg |
| Molecular Formula | C22H20BrNO2S |
| Molecular Weight | 442.36900 |
| Flash Point | 297.9ºC |
| Exact Mass | 441.04000 |
| PSA | 88.62000 |
| LogP | 5.58640 |
| Index of Refraction | 1.655 |
| InChIKey | CZMPYTSSFVPFPE-UHFFFAOYSA-N |
| SMILES | NC(CSC(c1ccccc1)(c1ccccc1)c1ccc(Br)cc1)C(=O)O |
|
~%
L-Cysteine, S-[... CAS#:61137-67-5 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 414 - 418 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |