L-Cysteine, S-[tris (4-methylphenyl)methyl]- structure
|
Common Name | L-Cysteine, S-[tris (4-methylphenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 61137-69-7 | Molecular Weight | 405.55200 | |
| Density | 1.179g/cm3 | Boiling Point | 562.9ºC at 760 mmHg | |
| Molecular Formula | C25H27NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.2ºC | |
| Name | 2-amino-3-[tris(4-methylphenyl)methylsulfanyl]propanoic acid |
|---|
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 562.9ºC at 760 mmHg |
| Molecular Formula | C25H27NO2S |
| Molecular Weight | 405.55200 |
| Flash Point | 294.2ºC |
| Exact Mass | 405.17600 |
| PSA | 88.62000 |
| LogP | 5.74910 |
| Index of Refraction | 1.621 |
| InChIKey | GLGZDJARSLSKDT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(SCC(N)C(=O)O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
|
~%
L-Cysteine, S-[... CAS#:61137-69-7 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 414 - 418 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |