1,2,3,4,5,6-hexakis[(4-tert-butylphenyl)sulfanylmethyl]benzene structure
|
Common Name | 1,2,3,4,5,6-hexakis[(4-tert-butylphenyl)sulfanylmethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 61160-99-4 | Molecular Weight | 1147.87000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C72H90S6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4,5,6-hexakis[(4-tert-butylphenyl)sulfanylmethyl]benzene |
|---|
| Molecular Formula | C72H90S6 |
|---|---|
| Molecular Weight | 1147.87000 |
| Exact Mass | 1146.54000 |
| PSA | 151.80000 |
| LogP | 23.22540 |
| InChIKey | WYLMFLQMWWDMBK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(SCc2c(CSc3ccc(C(C)(C)C)cc3)c(CSc3ccc(C(C)(C)C)cc3)c(CSc3ccc(C(C)(C)C)cc3)c(CSc3ccc(C(C)(C)C)cc3)c2CSc2ccc(C(C)(C)C)cc2)cc1 |
|
~%
1,2,3,4,5,6-hex... CAS#:61160-99-4 |
| Literature: Hardy,A.D.U. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1979 , p. 1011 - 1019 |