2-[2-(3,5-dichlorophenyl)propan-2-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione structure
|
Common Name | 2-[2-(3,5-dichlorophenyl)propan-2-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6117-25-5 | Molecular Weight | 338.22800 | |
| Density | 1.36g/cm3 | Boiling Point | 456.5ºC at 760 mmHg | |
| Molecular Formula | C17H17Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.9ºC | |
| Name | 2-[2-(3,5-dichlorophenyl)propan-2-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 456.5ºC at 760 mmHg |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.22800 |
| Flash Point | 229.9ºC |
| Exact Mass | 337.06400 |
| PSA | 37.38000 |
| LogP | 4.40580 |
| Index of Refraction | 1.615 |
| InChIKey | FCXPACSYDKSNNN-UHFFFAOYSA-N |
| SMILES | CC(C)(c1cc(Cl)cc(Cl)c1)N1C(=O)C2=C(CCCC2)C1=O |
|
~72%
2-[2-(3,5-dichl... CAS#:6117-25-5 |
| Literature: Song, Jie; Malathong, Viengkham; Bertozzi, Carolyn R. Journal of the American Chemical Society, 2005 , vol. 127, # 10 p. 3366 - 3372 |
|
~%
2-[2-(3,5-dichl... CAS#:6117-25-5 |
| Literature: Sokolova,T.A.; Tikhodeeva,I.I. J. Gen. Chem. USSR (Engl. Transl.), 1961 , vol. 31, p. 2222 - 2224,2073 - 2075 |
| ethylene bis methacrylamide |
| N,N'-dimethacryloyl ethylenediamine |
| ethylene glycol dimethacrylate |
| N,N'-Dimethacryloyl-ethylendiamin |
| N,N'-ethylenedimethacrylamide |