4-methoxy-10H-phenothiazine 5,5-dioxide structure
|
Common Name | 4-methoxy-10H-phenothiazine 5,5-dioxide | ||
|---|---|---|---|---|
| CAS Number | 61174-83-2 | Molecular Weight | 261.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxy-10H-phenothiazine 5,5-dioxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11NO3S |
|---|---|
| Molecular Weight | 261.29600 |
| Exact Mass | 261.04600 |
| PSA | 63.78000 |
| LogP | 3.80380 |
| InChIKey | FJDISVRBXSGJOS-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1S(=O)(=O)c1ccccc1N2 |
|
~%
4-methoxy-10H-p... CAS#:61174-83-2 |
| Literature: Cadogan,J.I.G. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1749 - 1757 |
| 4-Methoxyphenothiazin-5,5-dioxid |
| 10H-Phenothiazine,4-methoxy-,5,5-dioxide |