(3-chloropropyl)tris(1-methylethoxy)silane structure
|
Common Name | (3-chloropropyl)tris(1-methylethoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 61214-14-0 | Molecular Weight | 282.87900 | |
| Density | 0.962g/cm3 | Boiling Point | 274.4ºC at 760 mmHg | |
| Molecular Formula | C12H27ClO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.3ºC | |
| Name | 3-chloropropyl-tri(propan-2-yloxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.962g/cm3 |
|---|---|
| Boiling Point | 274.4ºC at 760 mmHg |
| Molecular Formula | C12H27ClO3Si |
| Molecular Weight | 282.87900 |
| Flash Point | 100.3ºC |
| Exact Mass | 282.14200 |
| PSA | 27.69000 |
| LogP | 3.82920 |
| Index of Refraction | 1.432 |
| InChIKey | BBMMYRPBNQOFGU-UHFFFAOYSA-N |
| SMILES | CC(C)O[Si](CCCCl)(OC(C)C)OC(C)C |
| HS Code | 2931900090 |
|---|
|
~83%
(3-chloropropyl... CAS#:61214-14-0 |
| Literature: Besson, Eric; Mehdi, Ahmad; Lerner, Dan A.; Reye, Catherine; Corriu, Robert J. P. Journal of Materials Chemistry, 2005 , vol. 15, # 7 p. 803 - 809 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 262-665-5 |
| Silane,(3-chloropropyl)tris(1-methylethoxy) |
| g-Chloropropyltriisopropoxysilane |
| 3-Chloropropyltriisopropoxysilane |
| (3-Chloropropyl)tris(1-methylethoxy)silane |
| 3-chloro-1-propyltriisopropoxysilane |