3-Chloropropyl Tris(Trimethylsiloxy)Silane structure
|
Common Name | 3-Chloropropyl Tris(Trimethylsiloxy)Silane | ||
|---|---|---|---|---|
| CAS Number | 18077-31-1 | Molecular Weight | 373.184 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 301.8±44.0 °C at 760 mmHg | |
| Molecular Formula | C12H33ClO3Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.9±20.6 °C | |
| Name | 3-chloropropyl-tris(trimethylsilyloxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.8±44.0 °C at 760 mmHg |
| Molecular Formula | C12H33ClO3Si4 |
| Molecular Weight | 373.184 |
| Flash Point | 113.9±20.6 °C |
| Exact Mass | 372.119537 |
| PSA | 27.69000 |
| LogP | 7.51 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.426 |
| InChIKey | MMWCHSBIWFYBBL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](CCCCl)(O[Si](C)(C)C)O[Si](C)(C)C |
| Storage condition | 2~8℃,Seal |
|
~%
3-Chloropropyl ... CAS#:18077-31-1 |
| Literature: Journal of the American Chemical Society, , vol. 82, p. 3601 - 3604 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tris-trimethylsiloxy-3-chloropropylsilane |
| EINECS 241-985-9 |
| 3-(3-Chloropropyl)-1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]trisiloxane |
| Trisiloxane, 3-(3-chloropropyl)-1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]- |
| 3-Chloropropyl Tris(Trimethylsiloxy)Silane |