N,N'-Bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine structure
|
Common Name | N,N'-Bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 61260-55-7 | Molecular Weight | 394.681 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 478.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C24H50N4 | Melting Point | 63-65 °C(lit.) | |
| MSDS | N/A | Flash Point | 246.8±23.8 °C | |
| Name | N,N'-Bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.5±45.0 °C at 760 mmHg |
| Melting Point | 63-65 °C(lit.) |
| Molecular Formula | C24H50N4 |
| Molecular Weight | 394.681 |
| Flash Point | 246.8±23.8 °C |
| Exact Mass | 394.403534 |
| PSA | 48.12000 |
| LogP | 5.05 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | UKJARPDLRWBRAX-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(NCCCCCCNC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 3267 |
| WGK Germany | 2 |
| RTECS | MO1228500 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2933399090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 262-679-1 |
| a 31 |
| MFCD00191829 |
| 1,6-Hexanediamine, N,N-bis(2,2,6,6-tetramethyl-4-piperidinyl)- |
| n,n'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
| N,N'-bis-(2,2,6,6 Tetramethyl-4-piperidyl)hexamethylenediamine(HMBTAD) |