2-PYRROLIDINONE,3-AMINO-1-HYDROXY- structure
|
Common Name | 2-PYRROLIDINONE,3-AMINO-1-HYDROXY- | ||
|---|---|---|---|---|
| CAS Number | 6129-15-3 | Molecular Weight | 201.22100 | |
| Density | 1.138 g/mL at 25ºC(lit.) | Boiling Point | 110-115ºC/0.004 mmHg(lit.) | |
| Molecular Formula | C12H11NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 113ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-[(1R)-1-phenylethyl]pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 110-115ºC/0.004 mmHg(lit.) |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22100 |
| Flash Point | 113ºC |
| Exact Mass | 201.07900 |
| PSA | 37.38000 |
| LogP | 1.61050 |
| Index of Refraction | n20/D 1.556(lit.) |
| InChIKey | PWZXUQWQRVKGAH-SECBINFHSA-N |
| SMILES | CC(c1ccccc1)N1C(=O)C=CC1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Donnelly, I.H. et al.
J. Chem. Soc., Perkin Trans. II , 1821, (1996)
|
|
|
Oishi, T. et al.
Polymer 34 , 2644, (1993)
|
|
|
Baldwin, S.W. et al.
Tetrahedron Lett. 32 , 5877, (1991)
|
| MFCD00674054 |
| (R)-N-(1-phenylethyl)maleimide |
| (R)-(+)-N-(1-feniletil)maleimide |
| 1-((1R)-1-phenylethyl)azoline-2,5-dione |