TRX-0237 structure
|
Common Name | TRX-0237 | ||
|---|---|---|---|---|
| CAS Number | 613-11-6 | Molecular Weight | 285.40700 | |
| Density | 1.201g/cm3 | Boiling Point | 491.7ºC at 760 mmHg | |
| Molecular Formula | C16H19N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.2ºC | |
Use of TRX-0237TRX-0237 Methylate (Hydromethylthionine, Methylene blue) is a Tau aggregation inhibitor (TAI) with Ki of 0.12 uM for intracellular TAI activity. |
| Name | 3-N,3-N,7-N,7-N-tetramethyl-10H-phenothiazine-3,7-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 491.7ºC at 760 mmHg |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.40700 |
| Flash Point | 251.2ºC |
| Exact Mass | 285.13000 |
| PSA | 43.81000 |
| LogP | 4.16480 |
| Index of Refraction | 1.675 |
| InChIKey | QTWZICCBKBYHDM-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2 |
| leucoform |
| Reduced methylene blue |
| N,N,N',N'-Tetramethyl-10H-phenothiazine-3,7-diamine |
| Panatone |
| Leukomethylene blue |
| N3,N3,N7,N7-tetramethyl-10H-phenothiazine-3,7-diamine |
| methylene white |
| 2w9i |
| Leucomethylene blue |