2-(Tribromomethyl)quinoline structure
|
Common Name | 2-(Tribromomethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 613-53-6 | Molecular Weight | 379.873 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 365.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H6Br3N | Melting Point | 127-131 °C | |
| MSDS | N/A | Flash Point | 174.9±26.5 °C | |
| Name | alpha,alpha,alpha-tribromoquinaldine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.6±37.0 °C at 760 mmHg |
| Melting Point | 127-131 °C |
| Molecular Formula | C10H6Br3N |
| Molecular Weight | 379.873 |
| Flash Point | 174.9±26.5 °C |
| Exact Mass | 376.805023 |
| PSA | 12.89000 |
| LogP | 4.50 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.739 |
| InChIKey | UDYYQHILRSDDMP-UHFFFAOYSA-N |
| SMILES | BrC(Br)(Br)c1ccc2ccccc2n1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25-S37/39-S26 |
| RTECS | VC3250750 |
| HS Code | 2933499090 |
|
~%
2-(Tribromometh... CAS#:613-53-6 |
| Literature: Journal of the Chemical Society, , vol. 123, p. 2883 |
|
~%
2-(Tribromometh... CAS#:613-53-6 |
| Literature: Journal of the American Chemical Society, , vol. 59, p. 1494,1496 |
|
~%
Detail
|
| Literature: Journal of the Chemical Society, , vol. 123, p. 2883 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Quinoline, 2- (tribromomethyl)- |
| α,α,α-Tribromoquinaldine |
| EINECS 210-347-1 |
| Quinoline, 2-(tribromomethyl)- |
| 2-(Tribromomethyl)quinoline |
| MFCD00006755 |