1-(3-Carboxypyrid-2-yl)-2-phenyl-4-methyl-piperazine structure
|
Common Name | 1-(3-Carboxypyrid-2-yl)-2-phenyl-4-methyl-piperazine | ||
|---|---|---|---|---|
| CAS Number | 61338-13-4 | Molecular Weight | 297.352 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 494.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.8±28.7 °C | |
| Name | 2-(4-Methyl-2-phenylpiperazin-1-yl)nicotinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 494.3±45.0 °C at 760 mmHg |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.352 |
| Flash Point | 252.8±28.7 °C |
| Exact Mass | 297.147736 |
| PSA | 56.67000 |
| LogP | 1.92 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | HCVDLMUVEGPGGH-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2ncccc2C(=O)O)C(c2ccccc2)C1 |
| HS Code | 2933599090 |
|---|
|
~90%
1-(3-Carboxypyr... CAS#:61338-13-4 |
| Literature: Singer, Claude; Liberman, Anita; Finkelstein, Nina Patent: US2001/51718 A1, 2001 ; |
|
~%
1-(3-Carboxypyr... CAS#:61338-13-4 |
| Literature: US2002/95038 A1, ; |
|
~%
1-(3-Carboxypyr... CAS#:61338-13-4 |
| Literature: Organic Preparations and Procedures International, , vol. 39, # 4 p. 399 - 402 |
|
~%
1-(3-Carboxypyr... CAS#:61338-13-4 |
| Literature: Organic Preparations and Procedures International, , vol. 39, # 4 p. 399 - 402 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Pyridinecarboxylic acid, 2-(4-methyl-2-phenyl-1-piperazinyl)- |
| 2-(4-methyl-2-phenylpiperazin-1-yl)pyridine-3-carboxylic acid |
| 2-(4-Methyl-2-phenyl-1-piperazinyl)nicotinic acid |
| 2-(4-Methyl-2-phenylpiperazin-1-yl)nicotinic acid |
| 1-(3-Carboxy-2-pyridyl)-4-methyl-2-phenylpiperazine |
| 1-(3-Carboxypyrid-2-yl)-2-phenyl-4-methyl-piperazine |