2,3,3,4,4,4-hexafluoro-2-(1,1,2,2,2-pentafluoroethyl)butanoyl fluoride
Modify Date: 2025-12-01 11:21:56
2,3,3,4,4,4-hexafluoro-2-(1,1,2,2,2-pentafluoroethyl)butanoyl fluoride structure
|
Common Name | 2,3,3,4,4,4-hexafluoro-2-(1,1,2,2,2-pentafluoroethyl)butanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 61340-75-8 | Molecular Weight | 316.04400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F12O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,3,4,4,4-hexafluoro-2-(1,1,2,2,2-pentafluoroethyl)butanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6F12O |
|---|---|
| Molecular Weight | 316.04400 |
| Exact Mass | 315.97600 |
| PSA | 17.07000 |
| LogP | 3.58600 |
| InChIKey | NRCXZICNVUUVCI-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
|
~%
2,3,3,4,4,4-hex... CAS#:61340-75-8 |
| Literature: Abe,T. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 1888 - 1892 |
| 2-Pentafluorethyl-2,3,3,4,4,4-hexafluor-butyrylfluorid |