1-chloro-3,5-bis(prop-1-en-2-yl)benzene structure
|
Common Name | 1-chloro-3,5-bis(prop-1-en-2-yl)benzene | ||
|---|---|---|---|---|
| CAS Number | 61342-06-1 | Molecular Weight | 192.68500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13Cl | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-3,5-bis(prop-1-en-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13Cl |
|---|---|
| Molecular Weight | 192.68500 |
| Exact Mass | 192.07100 |
| LogP | 4.40620 |
| InChIKey | VZOMEPSNALTKIC-UHFFFAOYSA-N |
| SMILES | C=C(C)c1cc(Cl)cc(C(=C)C)c1 |
|
~%
1-chloro-3,5-bi... CAS#:61342-06-1 |
| Literature: Tamao,K. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 1958 - 1969 |
| 3,5-Di-isopropenyl-1-chlorbenzol |