1,4-dichloro-2,5-bis(prop-1-en-2-yl)benzene structure
|
Common Name | 1,4-dichloro-2,5-bis(prop-1-en-2-yl)benzene | ||
|---|---|---|---|---|
| CAS Number | 61342-07-2 | Molecular Weight | 227.13000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-dichloro-2,5-bis(prop-1-en-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12Cl2 |
|---|---|
| Molecular Weight | 227.13000 |
| Exact Mass | 226.03200 |
| LogP | 5.05960 |
| InChIKey | ZSZQIDFALWOQDT-UHFFFAOYSA-N |
| SMILES | C=C(C)c1cc(Cl)c(C(=C)C)cc1Cl |
|
~%
1,4-dichloro-2,... CAS#:61342-07-2 |
| Literature: Tamao,K. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 1958 - 1969 |
| 1,4-Dichlor-2,5-di-isopropenyl-benzol |