6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione
6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione structure
|
Common Name | 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 61352-46-3 | Molecular Weight | 195.14700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6FNO3 |
|---|---|
| Molecular Weight | 195.14700 |
| Exact Mass | 195.03300 |
| PSA | 52.21000 |
| LogP | 0.63080 |
| InChIKey | VJXAOHOECMTGFF-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)oc(=O)c2cc(F)ccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~55%
6-fluoro-1-meth... CAS#:61352-46-3 |
| Literature: AVANIR PHARMACEUTICALS Patent: WO2004/74218 A2, 2004 ; Location in patent: Page 108 ; |
|
~65%
6-fluoro-1-meth... CAS#:61352-46-3 |
| Literature: Guan, Zheng-Hui; Chen, Ming; Ren, Zhi-Hui Journal of the American Chemical Society, 2012 , vol. 134, # 42 p. 17490 - 17493,4 |
|
~%
6-fluoro-1-meth... CAS#:61352-46-3 |
| Literature: Joensson, Stig; Andersson, Gunnar; Fex, Tomas; Fristedt, Tomas; Hedlund, Gunnar; Jansson, Karl; Abramo, Lisbeth; Fritzson, Ingela; Pekarski, Olga; Runstroem, Anna; Sandin, Helena; Thuvesson, Ingela; Bjoerk, Anders Journal of Medicinal Chemistry, 2004 , vol. 47, # 8 p. 2075 - 2088 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-methyl 4-fluoroisatoic anhydride |
| 5-fluoro N-methylisatoic anhydride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione? |
| A: CAS number of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione is 61352-46-3. |
| Q: What is the Chinese name of 61352-46-3? |
| A: Chinese name of 61352-46-3 is 61352-46-3. |
| Q: What is the molecular formula of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione? |
| A: Molecular formula of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione is C9H6FNO3. |
| Q: What is the molecular weight of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione? |
| A: Molecular weight of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione is 195.14700. |
| Q: What is the InChIKey of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione? |
| A: InChIKey of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione is VJXAOHOECMTGFF-UHFFFAOYSA-N. |
| Q: What English synonyms does 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione have? |
| A: English synonyms of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione: N-methyl 4-fluoroisatoic anhydride, 5-fluoro N-methylisatoic anhydride. |
| Q: What is the polar surface area (PSA) of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione? |
| A: Polar surface area (PSA) of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione is 52.21000. |
| Q: What is the SMILES notation of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione? |
| A: SMILES notation of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione is Cn1c(=O)oc(=O)c2cc(F)ccc21. |
| Q: What is the English name of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione? |
| A: The English name of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione is 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione. |
| Q: What is the LogP of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione? |
| A: LogP of 6-fluoro-1-methyl-3,1-benzoxazine-2,4-dione is 0.63080. |